Name | 2-((4-Chlorophenylamino)methylene)malonic acid diethyl ester |
Synonyms | DIETHYL 2-[(4-CHLOROANILINO)METHYLENE]MALONATE diethyl 2-((4-chlorophenylaMino)Methylene)Malonate 2-((4-Chlorophenylamino)methylene)malonic acid diethyl ester 2-((4-CHLOROPHENYLAMINO)METHYLENE)MALONIC ACID DIETHYL ESTER Propanedioic acid, 2-[[(4-chlorophenyl)amino]methylene]-, 1,3-diethyl ester |
CAS | 19056-79-2 |
InChI | InChI=1/C14H16ClNO4/c1-3-19-13(17)12(14(18)20-4-2)9-16-11-7-5-10(15)6-8-11/h5-9,16H,3-4H2,1-2H3 |
Molecular Formula | C14H16ClNO4 |
Molar Mass | 297.73 |
Density | 1.257±0.06 g/cm3(Predicted) |
Melting Point | 45-46 °C |
Boling Point | 360.2±42.0 °C(Predicted) |
Flash Point | 171.7°C |
Vapor Presure | 2.25E-05mmHg at 25°C |
pKa | -1.42±0.70(Predicted) |
Storage Condition | 2-8℃ |
Refractive Index | 1.56 |
Use | This product is for scientific research only and shall not be used for other purposes. |